42844-93-9 Usage
General Description
"[1,3-dihydro-5,6-bis[[(2-hydroxy-1-naphthyl)methylene]amino]-2H-benzimidazol-2-onato(2-)-N5,N6,O5,O6]nickel" is a complex chemical compound. It incorporates elements such as nickel and features functional groups like hydroxyl and amino groups. This chemical is characterized by benzimidazole core structures, naphthyl groups and is a derivative of benzimidazolone. The structure also reveals the presence of coordination bonds with nickel. The detailed properties, production methods other specific applications of this chemical are not readily available in general resources, which suggests it might be a specialized compound used in certain scientific research or industrial applications. Notably, many Nickel compounds have significant uses, ranging from catalysts and batteries to coloring agents for ceramics.
Check Digit Verification of cas no
The CAS Registry Mumber 42844-93-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,8,4 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 42844-93:
(7*4)+(6*2)+(5*8)+(4*4)+(3*4)+(2*9)+(1*3)=129
129 % 10 = 9
So 42844-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C29H20N4O3.Ni/c34-27-11-9-17-5-1-3-7-19(17)21(27)15-30-23-13-25-26(33-29(36)32-25)14-24(23)31-16-22-20-8-4-2-6-18(20)10-12-28(22)35;/h1-16,34-35H,(H2,32,33,36);/q;+2/p-2/b30-15+,31-16+;