42959-99-9 Usage
Uses
Used in Organic Synthesis:
(2-bromo-3-nitrophenyl) phenyl ketone is used as a building block for the preparation of various organic compounds. Its unique structure allows for the formation of new chemical bonds and the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Industry:
(2-bromo-3-nitrophenyl) phenyl ketone is used as a starting material for the synthesis of various pharmacological agents. Its presence in the molecular structure can impart specific biological activities, making it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
(2-bromo-3-nitrophenyl) phenyl ketone is used in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties can contribute to the effectiveness of these products in controlling pests and promoting crop growth.
Used in Organic Dyes:
(2-bromo-3-nitrophenyl) phenyl ketone is used in the preparation of organic dyes due to its yellow color. These dyes can be used in various applications, such as textiles, plastics, and printing inks, to impart color and enhance the visual appeal of products.
It is important to handle (2-bromo-3-nitrophenyl) phenyl ketone with caution, as it may pose a hazard to both human health and the environment. Proper safety measures should be taken during its production, use, and disposal to minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 42959-99-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,9,5 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 42959-99:
(7*4)+(6*2)+(5*9)+(4*5)+(3*9)+(2*9)+(1*9)=159
159 % 10 = 9
So 42959-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H8BrNO3/c14-12-10(7-4-8-11(12)15(17)18)13(16)9-5-2-1-3-6-9/h1-8H