431987-06-3 Usage
Uses
Used in Pharmaceutical Industry:
3-[5-(4-METHOXY-PHENYL)-1H-PYRROL-2-YL]-PROPIONIC ACID is used as a pharmaceutical compound for its potential biological activity. Its unique structure allows it to be a candidate for the development of new drugs, targeting various diseases and conditions.
Used in Medicinal Chemistry Research:
3-[5-(4-METHOXY-PHENYL)-1H-PYRROL-2-YL]-PROPIONIC ACID serves as a research tool in medicinal chemistry. Its distinctive molecular structure makes it valuable for studying the interactions between compounds and biological targets, contributing to the advancement of drug discovery and design.
Check Digit Verification of cas no
The CAS Registry Mumber 431987-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,1,9,8 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 431987-06:
(8*4)+(7*3)+(6*1)+(5*9)+(4*8)+(3*7)+(2*0)+(1*6)=163
163 % 10 = 3
So 431987-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO3/c1-18-12-6-2-10(3-7-12)13-8-4-11(15-13)5-9-14(16)17/h2-4,6-8,15H,5,9H2,1H3,(H,16,17)/p-1
