4323-00-6 Usage
General Description
4-IODOACETAMIDOSALICYLIC ACID is a chemical compound that contains both a salicylic acid and an amide group, as well as an iodine atom. It has potential uses in the field of medicinal and pharmaceutical research, due to its unique chemical structure and potential pharmacological properties. The compound has been studied for its anti-inflammatory, analgesic, and antioxidant properties. Its potential applications include the development of new drugs for various medical conditions, including inflammation, pain, and oxidative stress. Additionally, its chemical structure allows for the possibility of further derivatization and modification, which can be useful in the development of new compounds with enhanced properties.
Check Digit Verification of cas no
The CAS Registry Mumber 4323-00-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,2 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4323-00:
(6*4)+(5*3)+(4*2)+(3*3)+(2*0)+(1*0)=56
56 % 10 = 6
So 4323-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H8INO4/c10-4-8(13)11-5-1-2-6(9(14)15)7(12)3-5/h1-3,12H,4H2,(H,11,13)(H,14,15)