433242-64-9 Usage
Uses
Used in Pharmaceutical Research:
2-(4,6-DIMETHYL-PYRIMIDIN-2-YLSULFANYL)-BUTYRIC ACID is used as a potential drug candidate for its potential therapeutic properties. It is being studied for its potential anti-inflammatory and immunomodulatory effects, which could be beneficial in treating various conditions that involve inflammation or immune system dysregulation.
Used in Anti-inflammatory Applications:
In the medical field, 2-(4,6-DIMETHYL-PYRIMIDIN-2-YLSULFANYL)-BUTYRIC ACID is used as an anti-inflammatory agent, targeting conditions characterized by excessive inflammation that can lead to tissue damage and chronic diseases.
Used in Immunomodulatory Applications:
2-(4,6-DIMETHYL-PYRIMIDIN-2-YLSULFANYL)-BUTYRIC ACID is also used as an immunomodulatory agent, aiming to regulate the immune response. This can be particularly useful in autoimmune diseases where the immune system mistakenly attacks the body's own tissues, or in conditions requiring immune suppression.
Check Digit Verification of cas no
The CAS Registry Mumber 433242-64-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,3,2,4 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 433242-64:
(8*4)+(7*3)+(6*3)+(5*2)+(4*4)+(3*2)+(2*6)+(1*4)=119
119 % 10 = 9
So 433242-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2S/c1-4-8(9(13)14)15-10-11-6(2)5-7(3)12-10/h5,8H,4H2,1-3H3,(H,13,14)/p-1/t8-/m1/s1
