433294-98-5 Usage
Uses
Used in Pharmaceutical Industry:
3,5-Dichloro-4-nitropyridine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new medicinal compounds. Its unique chemical structure allows for the creation of diverse drug candidates with potential therapeutic applications.
Used in Pesticide Industry:
In the agrochemical sector, 3,5-dichloro-4-nitropyridine is utilized as a precursor in the production of pesticides. Its incorporation aids in the development of effective pest control agents, enhancing crop protection and contributing to increased agricultural productivity.
Used in Dye Industry:
3,5-Dichloro-4-nitropyridine is employed as a chemical intermediate in the synthesis of dyes, contributing to the creation of a wide range of colorants used in various industries, such as textiles, plastics, and printing inks.
Used in Research and Development:
3,5-DICHLORO-4-NITROPYRIDINE is also used in the research and development of new chemical products, where its unique properties can be explored and harnessed for innovative applications across different fields. Its versatility as a synthetic intermediate makes it valuable in the advancement of chemical science and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 433294-98-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,3,2,9 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 433294-98:
(8*4)+(7*3)+(6*3)+(5*2)+(4*9)+(3*4)+(2*9)+(1*8)=155
155 % 10 = 5
So 433294-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H2Cl2N2O2/c6-3-1-8-2-4(7)5(3)9(10)11/h1-2H
