4333-22-6 Usage
Uses
Used in Peptide Synthesis:
PHENYLTHIOHYDANTOIN-NORLEUCINE is used as a protecting group for the amino acid norleucine in the field of peptide synthesis. It plays a crucial role in preventing unwanted side reactions from occurring during the synthesis process, ensuring the successful creation of peptide chains.
Used in Organic Synthesis:
PHENYLTHIOHYDANTOIN-NORLEUCINE is utilized as a valuable tool in organic synthesis, particularly for the development of pharmaceuticals and other bioactive compounds. Its unique structure and reactivity contribute to the advancement of chemical research and the creation of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4333-22-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,3 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4333-22:
(6*4)+(5*3)+(4*3)+(3*3)+(2*2)+(1*2)=66
66 % 10 = 6
So 4333-22-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2OS/c1-2-3-9-11-12(16)15(13(17)14-11)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,14,17)
