4347-32-4 Usage
Uses
Used in Pharmaceutical Industry:
Furan-2-boronic acid is used as a key intermediate for the synthesis of various pharmaceuticals. Its ability to form carbon-carbon bonds through coupling reactions allows for the creation of complex organic molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, Furan-2-boronic acid serves as a building block for the development of new agrochemicals. Its versatility in chemical reactions enables the synthesis of compounds with pesticidal, herbicidal, or other agricultural properties, contributing to the advancement of crop protection and management.
Used in Organic Synthesis:
Furan-2-boronic acid is utilized as a versatile reagent in organic synthesis for the creation of a wide range of organic compounds. Its ability to participate in various chemical reactions, including coupling reactions, makes it an essential component in the synthesis of complex organic molecules for various applications, such as materials science, chemical research, and the development of new compounds with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 4347-32-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,4 and 7 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4347-32:
(6*4)+(5*3)+(4*4)+(3*7)+(2*3)+(1*2)=84
84 % 10 = 4
So 4347-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BO3S/c7-1-4-2-10-3-5(4)6(8)9/h1-3,8-9H
4347-32-4Relevant articles and documents
TETRACYCLIC INDOLE DERIVATIVES AS ANTIVIRAL AGENTS
-
Page/Page column 52, (2010/11/08)
The present invention relates to tetracyclic indole compounds of formula (I); wherein R1, R2, A, Ar, W, X, Y and Z are defined herein, and pharmaceutically acceptable salts thereof, pharmaceutical compositions comprising them, and their use for the treatment or prevention of infection by hepatitis C virus.
