4349-08-0 Usage
Description
4(1H)-Pyrimidinone, 5-chloro(9CI) is a pyrimidine derivative with the molecular formula C4H3ClN2O, featuring a chlorine atom attached to the 5-position of the pyrimidinone ring. It is a significant intermediate in the synthesis of a wide range of pharmaceuticals, agrochemicals, and other organic compounds, making it a versatile building block in organic synthesis with potential applications in medicine, agriculture, and materials science.
Uses
Used in Pharmaceutical Industry:
4(1H)-Pyrimidinone, 5-chloro(9CI) is used as a key intermediate in the synthesis of antiviral and anticancer drugs. Its unique structure allows for the development of novel therapeutic agents that target specific viral and cancer-related pathways, contributing to the advancement of medical treatments.
Used in Agrochemical Industry:
In the agrochemical sector, 4(1H)-Pyrimidinone, 5-chloro(9CI) serves as a crucial component in the production of various pesticides and herbicides. Its incorporation into these compounds enhances their effectiveness in controlling pests and weeds, thereby improving crop yields and ensuring food security.
Used in Materials Science:
4(1H)-Pyrimidinone, 5-chloro(9CI) is utilized in the development of innovative materials and compounds for a variety of industrial applications. Its unique chemical properties enable the creation of new materials with improved performance characteristics, such as enhanced stability, reactivity, or selectivity, which can be applied in various industries, including electronics, coatings, and polymers.
Overall, 4(1H)-Pyrimidinone, 5-chloro(9CI) is a valuable chemical compound with diverse applications across different industries, showcasing its importance in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 4349-08-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,4 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4349-08:
(6*4)+(5*3)+(4*4)+(3*9)+(2*0)+(1*8)=90
90 % 10 = 0
So 4349-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H3ClN2O/c5-3-1-6-2-7-4(3)8/h1-2H,(H,6,7,8)
4349-08-0Relevant articles and documents
BENZIMIDAZOLE DERIVATIVES AND THEIR USE AS VANILLOID RECEPTOR LIGANDS
-
Page 75, (2008/06/13)
Compounds of formula (I) are useful in the treatment of vanilloid-receptor-meditated diseases, such as inflammatory or neuropathic pain and diseases involving sensory nerve function such as asthma, rheumatoid arthritis, osteoarthritis, inflammatory bowel disorders, urinary incontinence, migraine and psoriasis.
