435341-87-0 Usage
Description
5-Isobutyl-2-methyl-4-morpholin-4-ylmethyl-furan-3-carboxylic acid is a complex heterocyclic chemical compound characterized by a furan ring, a carboxylic acid group, and a morpholine moiety. 5-ISOBUTYL-2-METHYL-4-MORPHOLIN-4-YLMETHYL-FURAN-3-CARBOXYLIC ACID is distinguished by its hydrophobic properties due to the isobutyl and methyl groups, and its water solubility due to the carboxylic acid group. The morpholine ring suggests potential antifungal or antibacterial properties, making it a compound of interest for pharmaceutical research and development.
Uses
Used in Pharmaceutical Research and Development:
5-Isobutyl-2-methyl-4-morpholin-4-ylmethyl-furan-3-carboxylic acid is used as a compound of interest in pharmaceutical research and development due to its unique structural features and potential biological activity.
Used in Antifungal Applications:
In the pharmaceutical industry, 5-Isobutyl-2-methyl-4-morpholin-4-ylmethyl-furan-3-carboxylic acid is used as a potential antifungal agent, leveraging its morpholine ring to target fungal infections.
Used in Antibacterial Applications:
Similarly, this compound is used as a potential antibacterial agent, with its morpholine ring possibly contributing to its effectiveness against bacterial pathogens.
Used in Chemical Industry:
5-Isobutyl-2-methyl-4-morpholin-4-ylmethyl-furan-3-carboxylic acid is also used in the chemical industry for further investigation of its properties and potential applications, given its combination of hydrophobic and hydrophilic characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 435341-87-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,5,3,4 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 435341-87:
(8*4)+(7*3)+(6*5)+(5*3)+(4*4)+(3*1)+(2*8)+(1*7)=140
140 % 10 = 0
So 435341-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H23NO4/c1-10(2)8-13-12(9-16-4-6-19-7-5-16)14(15(17)18)11(3)20-13/h10H,4-9H2,1-3H3,(H,17,18)