435342-17-9 Usage
Uses
Used in Organic Synthesis:
Ethyl 2-aminothiazole-4-carboxylate hydrochloride is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique structure and functional groups make it a versatile component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
Ethyl 2-aminothiazole-4-carboxylate hydrochloride is used as an intermediate in the development of pharmaceuticals for its potential therapeutic properties. Its presence in the molecular structure of certain drugs can contribute to their efficacy and pharmacological activity.
Used in Research and Development:
In the field of research and development, Ethyl 2-aminothiazole-4-carboxylate hydrochloride is used as a research compound to explore its chemical properties, reactivity, and potential applications in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 435342-17-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,5,3,4 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 435342-17:
(8*4)+(7*3)+(6*5)+(5*3)+(4*4)+(3*2)+(2*1)+(1*7)=129
129 % 10 = 9
So 435342-17-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2S.ClH/c1-2-10-5(9)4-3-11-6(7)8-4;/h3H,2H2,1H3,(H2,7,8);1H
