435345-24-7 Usage
Description
[2-(3,4-DIMETHOXY-PHENYL)-ETHYL]-(2-FLUORO-BENZYL)-AMINE is a chemical compound with the molecular formula C18H22FNO2. It is a derivative of phenethylamine and possesses a benzylamine substructure. [2-(3,4-DIMETHOXY-PHENYL)-ETHYL]-(2-FLUORO-BENZYL)-AMINE contains a fluorine atom attached to a benzyl group and a 3,4-dimethoxyphenethylamine moiety. The presence of these functional groups could potentially confer unique properties and reactivity to the compound. Further research and testing would be necessary to fully understand the potential uses and impacts of this chemical.
Uses
[2-(3,4-DIMETHOXY-PHENYL)-ETHYL]-(2-FLUORO-BENZYL)-AMINE is used as a chemical intermediate for the synthesis of various pharmaceuticals and agrochemicals due to its unique functional groups and reactivity.
Used in Pharmaceutical Industry:
[2-(3,4-DIMETHOXY-PHENYL)-ETHYL]-(2-FLUORO-BENZYL)-AMINE is used as a building block for the development of new drugs, particularly in the areas of central nervous system disorders and cardiovascular diseases, owing to its potential to modulate specific receptors and pathways.
Used in Agrochemical Industry:
[2-(3,4-DIMETHOXY-PHENYL)-ETHYL]-(2-FLUORO-BENZYL)-AMINE is used as a precursor for the synthesis of novel pesticides and herbicides, leveraging its unique structure to target specific pests and weeds while minimizing environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 435345-24-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,5,3,4 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 435345-24:
(8*4)+(7*3)+(6*5)+(5*3)+(4*4)+(3*5)+(2*2)+(1*4)=137
137 % 10 = 7
So 435345-24-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H20FNO2/c1-20-16-8-7-13(11-17(16)21-2)9-10-19-12-14-5-3-4-6-15(14)18/h3-8,11,19H,9-10,12H2,1-2H3/p+1