436086-82-7 Usage
Uses
Used in Pharmaceutical Industry:
(4-ISOPROPYL-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE is used as a building block for the synthesis of various pharmaceutical compounds due to its reactivity and ability to form complexes. Its unique structure allows for the creation of new molecules with potential therapeutic properties.
Used in Chemical Synthesis:
In the chemical industry, (4-ISOPROPYL-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE is used as an intermediate in the synthesis of more complex organic molecules. Its functional groups can be further modified or reacted with other compounds to produce a wide range of products with specific applications.
Used in Material Science:
(4-ISOPROPYL-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE may also find applications in material science, where its unique structure could be utilized to develop new materials with specific properties, such as improved conductivity, strength, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-82-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 436086-82:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*8)+(1*2)=157
157 % 10 = 7
So 436086-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H28N2O/c1-15(2)17-6-4-16(5-7-17)14-18-8-3-9-19-10-12-20-13-11-19/h4-7,15,18H,3,8-14H2,1-2H3/p+2
