436086-82-7 Usage
General Description
The chemical compound "(4-ISOPROPYL-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE" is a complex organic molecule containing an isopropyl-benzyl group and a morpholin-4-yl-propyl group. It is classified as an amine, meaning it contains a nitrogen atom with at least one lone pair of electrons. Amines are commonly used in various industrial and pharmaceutical applications due to their reactivity and ability to form complexes with other compounds. The specific properties and uses of "(4-ISOPROPYL-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE" would depend on its exact molecular structure and functional groups present.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-82-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 436086-82:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*8)+(1*2)=157
157 % 10 = 7
So 436086-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H28N2O/c1-15(2)17-6-4-16(5-7-17)14-18-8-3-9-19-10-12-20-13-11-19/h4-7,15,18H,3,8-14H2,1-2H3/p+2
