436086-87-2 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-NITRO-PYRAZOL-1-YLMETHYL)-FURAN-2-CARBOXYLIC ACID is used as a pharmaceutical intermediate for the development of new drugs. Its unique chemical structure and properties allow it to be a potential candidate for the treatment of various diseases and conditions.
Used in Chemical Industry:
5-(4-NITRO-PYRAZOL-1-YLMETHYL)-FURAN-2-CARBOXYLIC ACID is used as a chemical intermediate for the synthesis of other organic compounds. Its versatile structure and reactivity make it suitable for the production of various chemical products, including dyes, pigments, and other specialty chemicals.
Used in Medicinal Chemistry Research:
5-(4-NITRO-PYRAZOL-1-YLMETHYL)-FURAN-2-CARBOXYLIC ACID is used as a research compound for exploring its biological activities and potential therapeutic applications. Its synthesis and chemical properties provide a foundation for further investigation into its interactions with biological targets and its efficacy in treating specific diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 436086-87:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*8)+(1*7)=162
162 % 10 = 2
So 436086-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O5/c13-9(14)8-2-1-7(17-8)5-11-4-6(3-10-11)12(15)16/h1-4H,5H2,(H,13,14)/p-1
