436087-23-9 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-AZEPAN-1-YL-PHENYL)-2-CHLORO-ACETAMIDE is used as a building block for the synthesis of various pharmaceutical compounds due to its unique structural features and potential applications in drug development. It contributes to the creation of new medications aimed at treating a range of diseases and disorders, enhancing the therapeutic options available in the healthcare sector.
Used in Organic Chemistry:
In the realm of organic chemistry, N-(4-AZEPAN-1-YL-PHENYL)-2-CHLORO-ACETAMIDE serves as a key intermediate in the synthesis of complex organic molecules. Its presence in the molecular structure allows for the exploration of novel chemical reactions and the development of innovative synthetic pathways, thereby expanding the scope of organic chemistry research and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 436087-23-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 7 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 436087-23:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*7)+(2*2)+(1*3)=149
149 % 10 = 9
So 436087-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H19ClN2O/c15-11-14(18)16-12-5-7-13(8-6-12)17-9-3-1-2-4-10-17/h5-8H,1-4,9-11H2,(H,16,18)
