436088-51-6 Usage
Description
[2-(2,5-DIOXO-HEXAHYDRO-IMIDAZO[4,5-D]IMIDAZOL-1-YL)-ACETYLAMINO]-ACETIC ACID is a synthetic compound characterized by a complex molecular structure that includes an acetylamine group, an acetic acid group, and a heterocyclic imidazole ring. This non-naturally occurring chemical is predominantly utilized in scientific research and pharmaceutical development, with its specific properties and potential applications necessitating further investigation and testing.
Uses
Used in Pharmaceutical Development:
[2-(2,5-DIOXO-HEXAHYDRO-IMIDAZO[4,5-D]IMIDAZOL-1-YL)-ACETYLAMINO]-ACETIC ACID is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique molecular structure, which features an acetylamine group and an acetic acid group, allows for its potential use in creating novel drugs with specific therapeutic properties.
Used in Scientific Research:
In the field of scientific research, [2-(2,5-DIOXO-HEXAHYDRO-IMIDAZO[4,5-D]IMIDAZOL-1-YL)-ACETYLAMINO]-ACETIC ACID serves as a valuable compound for studying the interactions between different molecular groups and their effects on biological systems. Its heterocyclic imidazole ring may offer insights into the design and development of new chemical entities with potential applications in various research areas.
Used in Chemical Synthesis:
[2-(2,5-DIOXO-HEXAHYDRO-IMIDAZO[4,5-D]IMIDAZOL-1-YL)-ACETYLAMINO]-ACETIC ACID is employed as a key building block in the synthesis of complex organic molecules. Its versatile structure enables the creation of a wide range of chemical products, from pharmaceuticals to advanced materials, by facilitating various chemical reactions and transformations.
Used in Drug Delivery Systems:
Similar to other complex molecular structures, [2-(2,5-DIOXO-HEXAHYDRO-IMIDAZO[4,5-D]IMIDAZOL-1-YL)-ACETYLAMINO]-ACETIC ACID may be utilized in the development of innovative drug delivery systems. Its unique properties could potentially enhance the delivery, bioavailability, and therapeutic outcomes of various pharmaceutical compounds, particularly in the context of targeted drug delivery and controlled release applications.
Check Digit Verification of cas no
The CAS Registry Mumber 436088-51-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 8 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 436088-51:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*8)+(2*5)+(1*1)=156
156 % 10 = 6
So 436088-51-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N5O5/c14-3(9-1-4(15)16)2-13-6-5(11-8(13)18)10-7(17)12-6/h5-6H,1-2H2,(H,9,14)(H,11,18)(H,15,16)(H2,10,12,17)/p-1/t5-,6+/m0/s1
436088-51-6Relevant articles and documents
Synthesis of 2-monofunctionalized 2,4,6,8-tetraazabicyclo[3.3.0]octane-3,7- diones
Kravchenko,Maksareva,Belyakov,Sigachev,Chegaev,Lyssenko,Lebedev,Makhova
, p. 192 - 197 (2003)
New (1R*,5S*)-2-R-2,4,6,8-tetraazabicyclo[3.3.0]octane-3,7- diones containing the terminal carboxy or hydroxy group in the substituent R were synthesized by cyclocondensation of 4,5-dihydroxyimidazolidin-2-one with 1-R-ureas. Single-crystal X-ray diffraction analysis showed that 2-carboxyethyl-2,4,6,8-tetraazabicyclo[3.3.0]octane-3,7-dione crystallizes as a racemate.
