436088-72-1 Usage
Description
(2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE, with the molecular formula C11H11ClNO, is a derivative of furan, a heterocyclic aromatic organic compound. It features a chloro-benzyl group and is widely recognized for its role in organic synthesis. This chemical is a versatile building block for the preparation of an array of pharmaceuticals and agrochemicals, and its potential biological and pharmacological properties have been a subject of study. (2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE's structural attributes make it a valuable asset in the fields of chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
(2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel drugs with potential therapeutic applications. Its unique structure allows for the creation of molecules that can target specific biological pathways, thereby enhancing the effectiveness of treatments for a range of diseases.
Used in Agrochemical Industry:
In the agrochemical sector, (2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE is utilized as a precursor in the production of pesticides and other crop protection agents. Its incorporation into these chemicals can lead to improved efficacy in protecting crops from pests and diseases, thus contributing to increased agricultural productivity.
Used in Organic Synthesis:
(2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE is employed as a building block in organic synthesis for its capacity to form a variety of complex organic compounds. This versatility makes it a valuable component in the creation of specialty chemicals used across different industries, including materials science and the development of new technologies.
Used in Research and Development:
(2-CHLORO-BENZYL)-FURAN-2-YLMETHYL-AMINE is also used in research and development settings as a tool to explore new chemical reactions and mechanisms. Its unique properties make it an interesting subject for scientific inquiry, potentially leading to breakthroughs in understanding and applications within the chemical and biological sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 436088-72-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 436088-72:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*8)+(2*7)+(1*2)=161
161 % 10 = 1
So 436088-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H12ClNO/c13-12-6-2-1-4-10(12)8-14-9-11-5-3-7-15-11/h1-7,14H,8-9H2/p+1
