436088-74-3 Usage
Description
4-(2-Pyrrolidin-1-yl-phenylcarbamoyl)-butyric acid is a chemical compound that features a butyric acid core with a pyrrolidin-1-yl-phenylcarbamoyl group attached at the 4-position. As a derivative of butyric acid, it contains a phenylcarbamoyl group with a pyrrolidin-1-yl substituent, which endows it with potential pharmaceutical applications and biological activity.
Uses
Used in Pharmaceutical Research and Drug Development:
4-(2-Pyrrolidin-1-yl-phenylcarbamoyl)-butyric acid is used as a potential candidate for pharmaceutical applications due to its biological activity and therapeutic properties. It is often employed in the research and development of new drugs, where its unique structure may contribute to the discovery of novel therapeutic agents.
Used as a Building Block for Synthesis:
In the pharmaceutical industry, 4-(2-Pyrrolidin-1-yl-phenylcarbamoyl)-butyric acid is used as a building block for the synthesis of other drugs. Its chemical structure allows for the creation of a variety of drug molecules, potentially leading to the development of new treatments for various diseases.
Used as a Reference Standard in Laboratory Analysis:
4-(2-Pyrrolidin-1-yl-phenylcarbamoyl)-butyric acid is also used as a reference standard in laboratory analysis. It serves as a benchmark for the identification and quantification of related compounds in various assays and tests, ensuring the accuracy and reliability of experimental results.
Check Digit Verification of cas no
The CAS Registry Mumber 436088-74-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 8 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 436088-74:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*8)+(2*7)+(1*4)=163
163 % 10 = 3
So 436088-74-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O3/c18-14(8-5-9-15(19)20)16-12-6-1-2-7-13(12)17-10-3-4-11-17/h1-2,6-7H,3-5,8-11H2,(H,16,18)(H,19,20)/p-1