436096-80-9 Usage
Uses
Since the provided materials do not specify any particular applications for (2-ETHOXY-BENZYL)-FURAN-2-YLMETHYL-AMINE, it is not possible to list specific uses for (2-ETHOXY-BENZYL)-FURAN-2-YLMETHYL-AMINE based on the information given. However, given its structure, it may find use in various chemical industries as a precursor or intermediate in the synthesis of pharmaceuticals, agrochemicals, or other specialty chemicals. Its potential applications would be determined by further research into its chemical behavior and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 436096-80-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,9 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 436096-80:
(8*4)+(7*3)+(6*6)+(5*0)+(4*9)+(3*6)+(2*8)+(1*0)=159
159 % 10 = 9
So 436096-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO2/c1-2-16-14-8-4-3-6-12(14)10-15-11-13-7-5-9-17-13/h3-9,15H,2,10-11H2,1H3/p+1
