436811-29-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(3-METHYL-4-OXO-THIAZOLIDIN-2-YLIDENEAMINO)-BENZOIC ACID is used as a building block for the synthesis of various pharmaceuticals. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 3-(3-METHYL-4-OXO-THIAZOLIDIN-2-YLIDENEAMINO)-BENZOIC ACID is utilized as a key component in the creation of agrochemicals. Its properties allow for the development of effective products for agricultural use, such as pesticides and herbicides.
Further studies are needed to fully understand the potential applications and effects of this chemical compound, as its biological activity and reactivity may lead to additional uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 436811-29-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,8,1 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 436811-29:
(8*4)+(7*3)+(6*6)+(5*8)+(4*1)+(3*1)+(2*2)+(1*9)=149
149 % 10 = 9
So 436811-29-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3S/c1-13-9(14)6-17-11(13)12-8-4-2-3-7(5-8)10(15)16/h2-5H,6H2,1H3,(H,15,16)/p-1/b12-11-
