4375-11-5 Usage
Uses
Used in Pharmaceutical Industry:
1,5-Diaminobiurea is used as a pharmaceutical intermediate for the production of antiviral drugs. Its unique structure allows it to play a crucial role in the synthesis of these medications, contributing to their antiviral properties.
Used in Polymer Chemistry:
In the field of polymer chemistry, 1,5-Diaminobiurea is utilized for its potential to contribute to the development of new polymeric materials. Its chemical properties make it a valuable component in the creation of innovative polymers with specific characteristics.
Used in High Energy Density Materials:
1,5-Diaminobiurea has been studied for its potential use as a nitrogen-rich high energy density material. Its high nitrogen content and energy density make it a candidate for applications where a compact and powerful energy source is required.
Overall, 1,5-Diaminobiurea's diverse applications across various industries highlight its versatility and importance in chemical and material science research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 4375-11-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,7 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4375-11:
(6*4)+(5*3)+(4*7)+(3*5)+(2*1)+(1*1)=85
85 % 10 = 5
So 4375-11-5 is a valid CAS Registry Number.
InChI:InChI=1/C2H7N5O2/c3-6-1(8)5-2(9)7-4/h3-4H2,(H3,5,6,7,8,9)
