4375-11-5 Usage
General Description
1,5-Diaminobiurea, also known as sinouracil, is a chemical compound that is a urea derivative. It is a colorless, crystalline solid that is soluble in water and has a melting point of 238-240°C. 1,5-Diaminobiurea is used as a pharmaceutical intermediate in the production of antiviral drugs, and it also has applications in the field of polymer chemistry. The compound has potential as a building block for the development of new pharmaceuticals due to its unique structure and properties. Additionally, 1,5-Diaminobiurea has been studied for its potential use as a nitrogen-rich high energy density material. Overall, this chemical compound has diverse uses and applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4375-11-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,7 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4375-11:
(6*4)+(5*3)+(4*7)+(3*5)+(2*1)+(1*1)=85
85 % 10 = 5
So 4375-11-5 is a valid CAS Registry Number.
InChI:InChI=1/C2H7N5O2/c3-6-1(8)5-2(9)7-4/h3-4H2,(H3,5,6,7,8,9)
