439106-75-9 Usage
Uses
Used in Pharmaceutical Synthesis:
Pyridine, 2-(1H-pyrazol-4-yl)(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals. The presence of both pyridine and pyrazole rings in its structure makes it a versatile building block for the development of new drugs with potential therapeutic applications.
Used in Research and Development:
In the field of chemistry and pharmaceutical research, Pyridine, 2-(1H-pyrazol-4-yl)(9CI) serves as a valuable compound for studying the properties and reactivity of heterocyclic organic compounds. It can be used to explore new reaction pathways and develop innovative synthetic methods for the preparation of complex molecules.
Although the provided materials do not offer detailed information about the specific applications, physical and chemical properties, sources, environmental fate, or potential health effects of Pyridine, 2-(1H-pyrazol-4-yl)(9CI), its role in pharmaceutical synthesis and research is well-established. Further investigation and studies are needed to fully understand its potential uses and implications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 439106-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,9,1,0 and 6 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 439106-75:
(8*4)+(7*3)+(6*9)+(5*1)+(4*0)+(3*6)+(2*7)+(1*5)=149
149 % 10 = 9
So 439106-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3/c1-2-4-9-8(3-1)7-5-10-11-6-7/h1-6H,(H,10,11)
