439108-20-0 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Pyrimidin-2-yl-propionic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its versatile chemical structure allows for the creation of a wide range of drugs with different therapeutic applications. The presence of the pyrimidine ring and propionic acid chain in its molecular structure makes it an ideal candidate for the development of new drugs with improved efficacy and safety profiles.
Used in Drug Design and Development:
In the field of drug design and development, 3-Pyrimidin-2-yl-propionic acid serves as a valuable building block for the creation of novel drug candidates. Its unique structure can be modified and functionalized to generate a diverse array of compounds with potential therapeutic benefits. Researchers can exploit its chemical properties to design drugs that target specific biological pathways or receptors, leading to the development of more effective treatments for various diseases and conditions.
Used in Medicinal Chemistry Research:
3-Pyrimidin-2-yl-propionic acid is also utilized in medicinal chemistry research to explore its potential as a therapeutic agent or as a structural component in the development of new drugs. Its unique molecular structure makes it an interesting subject for study, as it may exhibit novel biological activities or interact with biological targets in ways that are not yet fully understood. Through research and experimentation, scientists can gain valuable insights into the potential applications of 3-Pyrimidin-2-yl-propionic acid in the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 439108-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,9,1,0 and 8 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 439108-20:
(8*4)+(7*3)+(6*9)+(5*1)+(4*0)+(3*8)+(2*2)+(1*0)=140
140 % 10 = 0
So 439108-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c10-7(11)3-2-6-8-4-1-5-9-6/h1,4-5H,2-3H2,(H,10,11)