4396-62-7 Usage
Uses
Used in Food Industry:
Ethyl acetamidoethane thiolate is used as a flavoring agent for enhancing the taste and aroma of various food products. Its ability to impart a distinct flavor makes it a valuable ingredient in the culinary world.
Used in Cosmetic and Perfume Industries:
In the cosmetic and perfume industries, Ethyl acetamidoethane thiolate serves as a fragrance, adding a unique scent to a wide range of products. Its strong, yet customizable aroma makes it a popular choice for creating memorable scents.
Used in Organic Synthesis:
Ethyl acetamidoethane thiolate is utilized as a reagent in organic synthesis, playing a crucial role in the production of various chemical compounds. Its chemical properties allow it to participate in multiple reactions, making it a valuable component in the synthesis process.
Used in Pharmaceutical Products:
As a preservative in pharmaceutical products, Ethyl acetamidoethane thiolate helps maintain the stability and longevity of medications. Its ability to prevent the degradation of active ingredients is essential for ensuring the efficacy and safety of pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 4396-62-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,9 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4396-62:
(6*4)+(5*3)+(4*9)+(3*6)+(2*6)+(1*2)=107
107 % 10 = 7
So 4396-62-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2S/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8)
