4396-77-4 Usage
Derived from isoindole-1,3-dione
The compound is based on the isoindole-1,3-dione structure, which is a bicyclic aromatic system with a ketone group on both rings.
Contains a triazol-1-yl-ethyl substituent
The compound has a 1,2,3-triazol-1-yl group attached to an ethyl chain, which is further attached to the isoindole core.
Used in organic synthesis and medicinal chemistry
The compound is often utilized as a building block for the synthesis of various biologically active molecules.
Building block for the synthesis of biologically active molecules
This suggests that the compound can be further modified and used to create a wide range of molecules with potential applications in various fields.
Potential applications in pharmaceuticals, agrochemicals, and materials science
The compound has potential uses in the development of new drugs, pesticides, and other materials due to its unique properties.
Unique structural features
The combination of the isoindole-1,3-dione and 1,2,3-triazol-1-yl-ethyl substituent gives the compound a distinct structure that may impart unique chemical and physical properties.
Versatile chemical compound
The compound's structural features and potential reactivity make it a valuable compound for various research and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 4396-77-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,9 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4396-77:
(6*4)+(5*3)+(4*9)+(3*6)+(2*7)+(1*7)=114
114 % 10 = 4
So 4396-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N4O2/c17-11-9-3-1-2-4-10(9)12(18)16(11)8-7-15-6-5-13-14-15/h1-6H,7-8H2
