441015-89-0 Usage
Uses
As the provided materials do not specify any particular applications for (1R,2S,4S)-REL-4-HYDROXY-2-(4-METHYL-BENZOYL)-CYCLOHEXANECARBOXYLIC ACID, it is not possible to list its uses based on the information given. However, given its structural features and the potential for unique bioactivity due to its stereochemistry, it may find applications in various fields such as pharmaceuticals, materials science, or as a chemical intermediate in the synthesis of other compounds. Further research and development would be necessary to determine specific uses and validate any potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 441015-89-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,1,0,1 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 441015-89:
(8*4)+(7*4)+(6*1)+(5*0)+(4*1)+(3*5)+(2*8)+(1*9)=110
110 % 10 = 0
So 441015-89-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H18O4/c1-9-2-4-10(5-3-9)14(17)13-8-11(16)6-7-12(13)15(18)19/h2-5,11-13,16H,6-8H2,1H3,(H,18,19)/t11-,12+,13-/m0/s1
441015-89-0Relevant academic research and scientific papers
Szabo, Jozsef A.,Sohar, Pal,Csampai, Antal,Stajer, Geza
, p. 241 - 248 (2002)
Cyclohexane- and norbomanelactones (1, 5) as well as ketallactones (3, 7) and their hydrolytic products (2, 4a,b, 8) react with hydrazine hydrate to yield the hydroxy-substituted hexahydrophthalazinones 9-12. In the cyclizations, the configurations of the
