4412-24-2 Usage
Chemical class
Belongs to the class of phenothiazines, a group of tricyclic compounds with sulfur and nitrogen atoms in the ring structure.
Structure
Derived from phenothiazine with a carboxamide group at the 10th position, which introduces an additional nitrogen atom to the heterocyclic ring.
Heterocyclic ring
Contains a nitrogen-containing heterocyclic ring structure, which is characteristic of phenothiazine compounds.
Pharmaceutical applications
Often used as a building block in the synthesis of various pharmaceuticals and other organic compounds due to its versatile chemical structure.
Biological activities
Exhibits potential biological activities, such as antipsychotic, anti-inflammatory, and antifungal properties.
Medical conditions
Has been studied for its potential in the treatment of various medical conditions, making it a compound of interest in the field of medicinal chemistry.
Research focus
The compound's potential applications in medicine and pharmaceuticals make it a subject of ongoing research and development.
Synthesis
The synthesis of 10H-Phenothiazine-10-carboxamide typically involves the modification of the phenothiazine core structure by introducing a carboxamide group at the 10th position.
Chemical properties
The presence of the carboxamide group and the heterocyclic ring structure contribute to the compound's reactivity, solubility, and other chemical properties.
Safety and handling
As with any chemical compound, appropriate safety measures should be taken when handling 10H-Phenothiazine-10-carboxamide, including the use of personal protective equipment and proper disposal methods.
Check Digit Verification of cas no
The CAS Registry Mumber 4412-24-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,1 and 2 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4412-24:
(6*4)+(5*4)+(4*1)+(3*2)+(2*2)+(1*4)=62
62 % 10 = 2
So 4412-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2OS/c14-13(16)15-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)15/h1-8H,(H2,14,16)
