444080-03-9 Usage
Uses
Used in Pharmaceutical Production:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new medicinal compounds.
Used in Research and Development:
In the field of research and development, Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is used as a building block for creating new compounds with specific properties and functions, contributing to scientific advancements and innovation in various industries.
Used in Medicine:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is utilized in medicine for its potential applications in the treatment and management of various health conditions, thanks to its unique chemical structure and properties.
Used in Biochemistry:
In biochemistry, Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]- is employed for its role in understanding and manipulating biological processes, potentially leading to breakthroughs in the study of enzymes, metabolic pathways, and other biochemical phenomena.
Used in Organic Chemistry:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is also used in organic chemistry as a key component in the synthesis of complex organic molecules, facilitating the development of novel organic materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 444080-03-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,4,0,8 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 444080-03:
(8*4)+(7*4)+(6*4)+(5*0)+(4*8)+(3*0)+(2*0)+(1*3)=119
119 % 10 = 9
So 444080-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO5/c1-21-13-7-11(8-14(9-13)22-2)15(18)17-12-5-3-4-10(6-12)16(19)20/h3-9H,1-2H3,(H,17,18)(H,19,20)
