4465-96-7 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
β-Vinyl-1-aziridineethanol is used as a precursor in the synthesis of various pharmaceuticals and agrochemicals for its ability to contribute to the formation of complex molecular structures that can exhibit therapeutic or pesticidal properties.
Used in Polymer Production:
In the polymer industry, β-Vinyl-1-aziridineethanol is used as a monomer to create polymers with specific properties, such as enhanced stability or reactivity, which can be tailored for various applications.
Used as a Cross-Linking Agent in Coatings and Adhesives:
β-Vinyl-1-aziridineethanol is employed as a cross-linking agent in the manufacturing of coatings and adhesives to improve their durability, strength, and resistance to environmental factors. Its reactivity allows for the formation of strong bonds between polymer chains, enhancing the overall performance of the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 4465-96-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,6 and 5 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4465-96:
(6*4)+(5*4)+(4*6)+(3*5)+(2*9)+(1*6)=107
107 % 10 = 7
So 4465-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO/c1-2-6(5-8)7-3-4-7/h2,6,8H,1,3-5H2
