446831-28-3 Usage
Uses
Used in Pharmaceutical Industry:
3-(Piperazin-1-yl)benzoic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to interact with multiple biological targets. The presence of the piperazine group allows for the development of molecules with diverse therapeutic effects, while the benzoic acid group contributes to the compound's overall chemical profile and potential biological activities.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(Piperazin-1-yl)benzoic acid serves as a structural motif for the design of new bioactive molecules. Its versatility in binding to different biological targets makes it a valuable component in the creation of drugs with specific therapeutic purposes.
Used in Drug Development:
3-(Piperazin-1-yl)benzoic acid is employed in drug development as a precursor to potential therapeutic agents. Its chemical properties and interactions with biological targets make it a promising candidate for the development of new drugs with improved efficacy and selectivity in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 446831-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,6,8,3 and 1 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 446831-28:
(8*4)+(7*4)+(6*6)+(5*8)+(4*3)+(3*1)+(2*2)+(1*8)=163
163 % 10 = 3
So 446831-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O2/c14-11(15)9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2,(H,14,15)
