446831-28-3 Usage
General Description
3-(Piperazin-1-yl)benzoic acid is a chemical compound with the molecular formula C12H14N2O2. It is a piperazine derivative with a benzoic acid group attached to the piperazine ring. 3-(Piperazin-1-yl)benzoic acid has potential pharmaceutical applications, particularly in the field of medicinal chemistry and drug development. The piperazine group in the molecule is known to interact with various biological targets, making it a key structural motif in the design of bioactive molecules. Additionally, the presence of the benzoic acid group can contribute to the compound's chemical properties and potential biological activities. Overall, 3-(Piperazin-1-yl)benzoic acid is a versatile chemical with potential applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 446831-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,6,8,3 and 1 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 446831-28:
(8*4)+(7*4)+(6*6)+(5*8)+(4*3)+(3*1)+(2*2)+(1*8)=163
163 % 10 = 3
So 446831-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O2/c14-11(15)9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2,(H,14,15)
