449199-19-3 Usage
Structure
Quinoline ring with three methyl groups at the 2, 7, and 8 positions and a hydroxyl group at the 4 position
Type
Chemical compound
Derivative
Quinoline
Potential Applications
Biological and pharmaceutical applications, due to structural similarities to other quinoline derivatives and ability to form complexes with various metals
Properties
Antioxidant and antimicrobial properties, making it of interest for further research and potential use in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 449199-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,9,1,9 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 449199-19:
(8*4)+(7*4)+(6*9)+(5*1)+(4*9)+(3*9)+(2*1)+(1*9)=193
193 % 10 = 3
So 449199-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO/c1-7-4-5-10-11(14)6-8(2)13-12(10)9(7)3/h4-6H,1-3H3,(H,13,14)
