449799-30-8 Usage
Description
1-Imidazo[2,1-b][1,3]thiazol-6-ylmethanamine is a chemical compound with the molecular formula C6H7N3S. It is a derivative of imidazole and thiazole, known for its potential pharmacological activities, particularly in the field of neuroscience, due to its ability to modulate certain receptors in the brain. It is also used as a building block in the synthesis of various organic compounds, making it a valuable chemical for both scientific and industrial applications.
Uses
Used in Pharmaceutical Research and Drug Development:
1-Imidazo[2,1-b][1,3]thiazol-6-ylmethanamine is used as a chemical compound in pharmaceutical research and drug development for its potential pharmacological activities. Its ability to modulate certain receptors in the brain makes it a promising candidate for the development of new drugs targeting neurological disorders.
Used in Neuroscience Applications:
In the field of neuroscience, 1-Imidazo[2,1-b][1,3]thiazol-6-ylmethanamine is used as a research tool to study the effects of modulating specific brain receptors. This can help in understanding the underlying mechanisms of various neurological conditions and aid in the development of targeted therapies.
Used in Organic Synthesis:
1-Imidazo[2,1-b][1,3]thiazol-6-ylmethanamine is used as a building block in the synthesis of various organic compounds. Its unique chemical structure allows for the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Chemical Research:
In chemical research, 1-Imidazo[2,1-b][1,3]thiazol-6-ylmethanamine is used to explore its properties and potential reactions with other compounds. This can lead to the discovery of new chemical reactions and the development of novel synthetic routes for the production of valuable chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 449799-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,9,7,9 and 9 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 449799-30:
(8*4)+(7*4)+(6*9)+(5*7)+(4*9)+(3*9)+(2*3)+(1*0)=218
218 % 10 = 8
So 449799-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3S/c7-3-5-4-9-1-2-10-6(9)8-5/h1-2,4H,3,7H2