45024-21-3 Usage
Uses
Used in Polymer Production:
5-methylnonane-1,9-diamine is used as a monomer in the production of polymers for its ability to react with other monomers to form polymer chains. Its presence in the polymer backbone can influence the properties of the resulting polymer, such as flexibility, strength, and chemical resistance.
Used in Organic Synthesis:
In the field of organic synthesis, 5-methylnonane-1,9-diamine is used as a building block for the synthesis of more complex organic compounds. Its reactive amino groups can participate in various chemical reactions, such as condensation, substitution, and addition reactions, making it a versatile component in the creation of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Research:
5-methylnonane-1,9-diamine is utilized in chemical research as a model compound to study the properties and reactivity of amines and diamines. Its unique structure allows researchers to investigate the effects of different substituents on the reactivity and selectivity of amine groups, contributing to the understanding of amine chemistry and its applications.
Used in Surface Treatments:
5-methylnonane-1,9-diamine can be used in surface treatments, such as coatings and adhesives, due to its ability to form strong bonds with various substrates. Its adhesion-promoting properties can enhance the durability and performance of coated surfaces in various industries, including automotive, aerospace, and electronics.
Used in Textile Industry:
In the textile industry, 5-methylnonane-1,9-diamine may be employed as a component in dyeing and finishing processes. Its reactive amino groups can form covalent bonds with fabric fibers, improving colorfastness and the overall quality of the finished textile products.
Check Digit Verification of cas no
The CAS Registry Mumber 45024-21-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,0,2 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 45024-21:
(7*4)+(6*5)+(5*0)+(4*2)+(3*4)+(2*2)+(1*1)=83
83 % 10 = 3
So 45024-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H24N2/c1-10(6-2-4-8-11)7-3-5-9-12/h10H,2-9,11-12H2,1H3
45024-21-3Relevant academic research and scientific papers
Silicone containing bis-thioether aromatic amines
-
, (2008/06/13)
A silicone containing bis-thioether aromatic amine has a chemical structure wherein an aromatic nucleus at each end of the chemical radical is chemically bonded to the remainder of the chemical radical by either sulfur, sulfoxide or sulfone.
