451-44-5 Usage
Uses
Used in Chemical Synthesis:
3-Fluoro-1-(4-hydroxyphenyl)propan-1-one is used as a key intermediate in the synthesis of various organic compounds. Its unique structure, which includes a fluorine atom, phenol group, and propanone group, allows it to participate in a wide range of chemical reactions, making it a valuable building block for the creation of new molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-Fluoro-1-(4-hydroxyphenyl)propan-1-one is utilized as a starting material for the development of new drugs. Its distinctive chemical properties and reactivity make it a promising candidate for the design and synthesis of innovative pharmaceutical agents with potential therapeutic applications.
Used in Drug Discovery:
3-Fluoro-1-(4-hydroxyphenyl)propan-1-one is employed in drug discovery processes to identify novel compounds with potential medicinal properties. Its unique structure and reactivity enable researchers to explore its interactions with biological targets, which can lead to the development of new therapeutic agents.
Used in Chemical Research:
3-fluoro-1-(4-hydroxyphenyl)propan-1-one is also used in chemical research to study the effects of fluorination and the presence of phenol and propanone groups on the reactivity and properties of organic molecules. Understanding these effects can provide insights into the design of new chemical processes and the development of advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 451-44-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,5 and 1 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 451-44:
(5*4)+(4*5)+(3*1)+(2*4)+(1*4)=55
55 % 10 = 5
So 451-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9FO2/c10-6-5-9(12)7-1-3-8(11)4-2-7/h1-4,11H,5-6H2
