4514-54-9 Usage
Uses
Used in Organic Synthesis:
6-(3-Chlorophenyl)-1,3,5-triazine-2,4-diamine is used as a building block in organic synthesis for the preparation of various derivatives with potentially useful properties. Its unique structure allows for the development of new compounds with diverse applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine is used as a starting material for the synthesis of compounds with potential therapeutic applications. Its chemical properties make it a promising candidate for the development of new drugs.
Used in Cancer Research:
6-(3-Chlorophenyl)-1,3,5-triazine-2,4-diamine is being investigated for its potential as an anti-cancer agent. Its ability to inhibit certain cellular processes makes it a candidate for further research and development in cancer treatment.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine is used as a key intermediate in the synthesis of drugs with potential therapeutic benefits. Its unique structure and properties contribute to the development of innovative pharmaceutical compounds.
Used in Chemical Research:
6-(3-Chlorophenyl)-1,3,5-triazine-2,4-diamine is utilized in chemical research to explore its properties and potential applications. Its study contributes to the understanding of triazine compounds and their role in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 4514-54-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,1 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4514-54:
(6*4)+(5*5)+(4*1)+(3*4)+(2*5)+(1*4)=79
79 % 10 = 9
So 4514-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClN5/c10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15)
4514-54-9Relevant academic research and scientific papers
ANTICANCER COMPOSITION AND COMPOUND
-
, (2008/06/13)
An anticancer composition containing a compound represented by general formula (I) or a pharmacologically acceptable acid addition salt thereof. In formula (I), R10 and R20 may be the same or different from each other and each represents hydrogen, halogen, amino, aralkylamino, nitro, lower alkyl, lower alkoxy, lower alkoxyalkoxy, lower aralkyloxy or acyl; R30 and R40 may be the same or different from each other and each represents hydrogen, nicotinoyl, benzoyl or lower alkoxy; and n represents 0 or 1.
