455-95-8 Usage
General Description
Dodecylsuccinic acid is a relatively long-chain carboxylic acid that is used as a surfactant and corrosion inhibitor in various industrial applications. It is derived from succinic acid by replacing one of the hydrogen atoms with a dodecyl group, resulting in a hydrophobic tail that allows the molecule to interact with both water and organic compounds. Dodecylsuccinic acid is commonly used in metalworking fluids, lubricants, and rust preventatives due to its ability to form protective films on metal surfaces, which helps prevent corrosion. Additionally, it is used in the production of detergents and cleaning agents where its surfactant properties aid in reducing surface tension and improving the spread of the products. Overall, dodecylsuccinic acid is a versatile chemical with numerous industrial applications due to its surfactant and corrosion inhibition properties.
Check Digit Verification of cas no
The CAS Registry Mumber 455-95-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,5 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 455-95:
(5*4)+(4*5)+(3*5)+(2*9)+(1*5)=78
78 % 10 = 8
So 455-95-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18/h14H,2-13H2,1H3,(H,17,18)(H,19,20)
