455264-97-8 Usage
Uses
1. Used in Chemical Synthesis:
Spiro[3.5]nonane-1,3-dione is used as an intermediate in the synthesis of various complex organic compounds due to its unique spiro structure and carbonyl functional groups. Its ability to form stable intermediates makes it a valuable building block in the preparation of pharmaceuticals, agrochemicals, and other specialty chemicals.
2. Used in Material Science:
In the field of material science, Spiro[3.5]nonane-1,3-dione is used as a precursor for the development of novel materials with specific properties. Its unique molecular structure allows for the creation of new polymers, resins, and other materials with potential applications in coatings, adhesives, and composites.
3. Used in Pharmaceutical Industry:
Spiro[3.5]nonane-1,3-dione is used as a key component in the design and synthesis of new drug molecules. Its presence in the molecular structure can influence the pharmacokinetic and pharmacodynamic properties of the drug, making it an important player in drug discovery and development.
4. Used in Analytical Chemistry:
As a reference compound, Spiro[3.5]nonane-1,3-dione is used in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its unique structure and properties make it a valuable tool for researchers in the field of analytical chemistry.
5. Used in Research and Development:
In academic and industrial research settings, Spiro[3.5]nonane-1,3-dione is used as a model compound to study the effects of spiro structures on the properties and reactivity of molecules. This helps researchers gain a deeper understanding of the underlying chemical principles and develop new strategies for the synthesis and application of spiro compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 455264-97-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,5,2,6 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 455264-97:
(8*4)+(7*5)+(6*5)+(5*2)+(4*6)+(3*4)+(2*9)+(1*7)=168
168 % 10 = 8
So 455264-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12O2/c10-7-6-8(11)9(7)4-2-1-3-5-9/h1-6H2
455264-97-8Relevant academic research and scientific papers
Efficient synthesis of 3-aminocyclobut-2-en-1-ones: Squaramide surrogates as potent VLA-4 antagonists
Brand, Stephen,De Candole, Benjamin C.,Brown, Julien A.
, p. 2343 - 2346 (2007/10/03)
(Matrix presented) A novel series of uniquely functionalized 3-aminocyclobut-2-en-1-ones has been prepared by facile condensation of a variety of cyclobuta-1,3-diones with a phenylalanine-derived primary amine. These systems subsequently lend themselves t