4569-88-4 Usage
Uses
Used in Textile Industry:
INDOINE BLUE is used as a dye for cotton fabrics, providing good light fastness, perspiration fastness, ironing fastness, and soaping properties. It is suitable for various applications, such as clothing, home textiles, and other textile products.
Used in Chemical Industry:
INDOINE BLUE's unique chemical properties make it useful in various chemical applications, such as pH indicators, analytical reagents, and research purposes.
Used in Art and Crafts:
Due to its vibrant color and unique chemical properties, INDOINE BLUE can be used in art and crafts projects, such as painting, dyeing, and other creative endeavors.
Used in Analytical Chemistry:
INDOINE BLUE can be used as an analytical reagent in various chemical analyses, such as spectrophotometry, chromatography, and other laboratory techniques.
Used in Research and Development:
INDOINE BLUE's unique properties make it a valuable compound for research and development purposes, such as studying chemical reactions, developing new dyes and pigments, and exploring potential applications in various industries.
Preparation
(C.I.Basic Red 2, C.I. 50240) diazo, and Naphthalen-2-ol coupling.
Hazard
A poison.
Standard( Cotton )
Light Fastness
Fading
Stain
Check Digit Verification of cas no
The CAS Registry Mumber 4569-88-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,6 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4569-88:
(6*4)+(5*5)+(4*6)+(3*9)+(2*8)+(1*8)=124
124 % 10 = 4
So 4569-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C30H23N5O.ClH/c1-18-14-25-27(16-23(18)31)35(21-9-4-3-5-10-21)28-17-24(19(2)15-26(28)32-25)33-34-30-22-11-7-6-8-20(22)12-13-29(30)36;/h3-17H,1-2H3,(H2,31,33,36);1H