45695-84-9 Usage
Uses
Used in Pharmaceutical Industry:
PIPERAZINE-1-CARBOXAMIDINE is used as a precursor in the synthesis of various pharmaceutical compounds, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for versatile reactions and modifications, making it a valuable component in medicinal chemistry.
Used in Organic Chemistry:
In the field of organic chemistry, PIPERAZINE-1-CARBOXAMIDINE serves as a key intermediate for the synthesis of a wide range of organic molecules. Its reactivity and functional group compatibility enable the creation of diverse chemical entities with potential applications in various industries.
Used in Drug Development:
PIPERAZINE-1-CARBOXAMIDINE is being investigated for its potential biological activities, which may lead to the discovery of new therapeutic agents. Its role in drug development is crucial, as it can be utilized to create novel compounds with specific pharmacological properties, addressing unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 45695-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,6,9 and 5 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 45695-84:
(7*4)+(6*5)+(5*6)+(4*9)+(3*5)+(2*8)+(1*4)=159
159 % 10 = 9
So 45695-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N4/c6-5(7)9-3-1-8-2-4-9/h8H,1-4H2,(H3,6,7)
