458532-99-5 Usage
Uses
Used in Pharmaceutical Research:
3-BROMOPYRIDIN-4-YLBORONIC ACID is used as a reagent for the synthesis of potential therapeutic agents, particularly in the development of new drugs. Its involvement in Suzuki-Miyaura cross-coupling reactions allows for the creation of carbon-carbon bonds, which are essential in medicinal chemistry.
Used in Organic Syntheses:
3-BROMOPYRIDIN-4-YLBORONIC ACID is used as a key component in various organic syntheses, where its stability and selectivity contribute to the formation of complex molecules and compounds.
Used in Chemical Modifications:
3-BROMOPYRIDIN-4-YLBORONIC ACID is used as a platform for chemical modifications, thanks to its pyridine ring structure, which allows for the attachment of different functional groups and the creation of novel compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 458532-99-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,8,5,3 and 2 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 458532-99:
(8*4)+(7*5)+(6*8)+(5*5)+(4*3)+(3*2)+(2*9)+(1*9)=185
185 % 10 = 5
So 458532-99-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BBrNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3,9-10H
458532-99-5Relevant academic research and scientific papers
Synthesis of novel halopyridinylboronic acids and esters. Part 3: 2, or 3-Halopyridin-4-yl-boronic acids and esters
Bouillon, Alexandre,Lancelot, Jean-Charles,Collot, Valérie,Bovy, Philippe R,Rault, Sylvain
, p. 4369 - 4373 (2007/10/03)
This paper describes a general method for the synthesis and the isolation of novel 2, or 3-halopyridin-4-yl-boronic acids and esters 12-14, 18-20. These compounds are prepared taking in account a regioselective halogen-metal exchange using nBuLi or direct
