45887-08-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(1H-PYRAZOL-3-YL)PYRIDINE is used as a building block for the synthesis of various bioactive compounds due to its unique structure and properties. It plays a crucial role in the development of new drugs and agrochemicals, contributing to advancements in healthcare and agriculture.
Used in Coordination Chemistry:
3-(1H-PYRAZOL-3-YL)PYRIDINE is used as a ligand, enabling the formation of coordination compounds with metal ions. This application is vital in the study and development of new materials with specific properties and potential applications in various fields, such as catalysis, sensing, and energy storage.
Used in Organic Synthesis:
3-(1H-PYRAZOL-3-YL)PYRIDINE is used as a reagent in organic synthesis, facilitating the formation of new chemical entities and contributing to the discovery of novel compounds with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Used in the Development of Advanced Materials:
3-(1H-PYRAZOL-3-YL)PYRIDINE is used in the development of new pharmaceuticals and other advanced materials due to its unique structure and properties. Its potential applications in material science and pharmaceutical research are vast, offering opportunities for the creation of innovative products and solutions to address various challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 45887-08-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,8,8 and 7 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 45887-08:
(7*4)+(6*5)+(5*8)+(4*8)+(3*7)+(2*0)+(1*8)=159
159 % 10 = 9
So 45887-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3/c1-2-7(6-9-4-1)8-3-5-10-11-8/h1-6H,(H,10,11)
