45895-09-8 Usage
Structure
Cyclohexane ring with two hydroxyl groups at the 1 and 2 positions, and an epoxide group at the 4 position
Applications
a. Organic synthesis and chemical reactions
b. Building block for industrial chemicals and pharmaceuticals
c. Solubilizer, emollient, and stabilizer in cosmetics and personal care products
d. Production of adhesives, sealants, and coatings
Functional groups
Hydroxyl (-OH) and epoxide (-O-)
Chemical properties
a. Reactivity with electrophiles due to the presence of electron-rich epoxide group
b. Ability to form hydrogen bonds due to hydroxyl groups
c. Potential for intramolecular hydrogen bonding within the molecule
Physical properties
a. Likely a liquid or solid at room temperature, depending on the specific isomer
b. May exhibit hygroscopic properties due to the presence of hydroxyl groups
c. Solubility in polar solvents like water and alcohols
Safety
a. Potential irritant or allergen due to the presence of reactive functional groups
b. Proper handling and storage required to minimize exposure and environmental impact
c. May require specific disposal methods due to its reactivity and potential toxicity
Isomers
The compound may have different isomers based on the stereochemistry of the cyclohexane ring and the position of the hydroxyl and epoxide groups.
Check Digit Verification of cas no
The CAS Registry Mumber 45895-09-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,8,9 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 45895-09:
(7*4)+(6*5)+(5*8)+(4*9)+(3*5)+(2*0)+(1*9)=158
158 % 10 = 8
So 45895-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O3/c9-6-2-1-5(3-7(6)10)8-4-11-8/h5-10H,1-4H2
