459166-03-1 Usage
Uses
Used in Pharmaceutical Industry:
(S)-ALFA-AMINO-4-PIPERIDINE ACETIC ACID is used as a key intermediate in the synthesis of various medications for its ability to contribute to the development of antiviral and antidiabetic drugs. Its unique structure allows for the creation of pharmaceuticals that can effectively target and treat specific conditions.
Used in Agricultural Industry:
(S)-ALFA-AMINO-4-PIPERIDINE ACETIC ACID is used as a building block in the development of new pesticides and herbicides due to its potential to enhance the effectiveness of these agricultural chemicals. Its incorporation into these products can lead to improved crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 459166-03-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,9,1,6 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 459166-03:
(8*4)+(7*5)+(6*9)+(5*1)+(4*6)+(3*6)+(2*0)+(1*3)=171
171 % 10 = 1
So 459166-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2O2/c8-6(7(10)11)5-1-3-9-4-2-5/h5-6,9H,1-4,8H2,(H,10,11)/t6-/m0/s1