45957-41-3 Usage
Description
4-Pyridinylmethylguanidine, a chemical compound with the molecular formula C7H10N4, is a guanidine derivative featuring a pyridine ring attached to the guanidine moiety. This versatile compound is recognized for its unique structure and reactivity, making it valuable in a range of chemical and biological applications, particularly in organic and medicinal chemistry.
Uses
Used in Organic Chemistry:
4-Pyridinylmethylguanidine is utilized as a reagent for its catalytic properties in various organic reactions. It is known to facilitate the synthesis of heterocyclic compounds and the formation of carbon-carbon bonds, contributing to the advancement of organic synthesis techniques.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-Pyridinylmethylguanidine is employed as a reagent for its potential to catalyze reactions that are crucial in the development of pharmaceutical compounds. Its ability to bind to and modulate certain biological targets positions it as a promising candidate for the discovery of new drugs and therapeutic agents.
Used in the Development of Catalysts:
4-Pyridinylmethylguanidine is also used as a component in the development of catalysts that can enhance the efficiency and selectivity of chemical reactions. Its unique structure allows it to interact with reactants in specific ways, making it a valuable asset in the design of new catalysts for industrial and research applications.
Used in Biological Research:
Due to its potential pharmacological properties, 4-Pyridinylmethylguanidine is used in biological research to study its interactions with biological targets. This research can lead to a better understanding of its effects and possible applications in medicine, such as the development of new treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 45957-41-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,9,5 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 45957-41:
(7*4)+(6*5)+(5*9)+(4*5)+(3*7)+(2*4)+(1*1)=153
153 % 10 = 3
So 45957-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N4/c8-7(9)11-5-6-1-3-10-4-2-6/h1-4H,5H2,(H4,8,9,11)