45965-36-4

Usage

Uses

Used in Pharmaceutical Industry:
(4-OXO-4H-PYRIDIN-1-YL)ACETIC ACID is used as a precursor for the production of various pharmaceuticals, leveraging its ability to be a building block in the synthesis of complex organic molecules. Its presence in the synthesis process contributes to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, (4-OXO-4H-PYRIDIN-1-YL)ACETIC ACID is utilized as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its role in these applications is to provide a foundation for the creation of compounds that can effectively control, repel, or kill pests and weeds in agricultural settings.
Used in Organic Synthesis:
(4-OXO-4H-PYRIDIN-1-YL)ACETIC ACID is used as a key intermediate in organic synthesis for the formation of heterocyclic compounds. Its structural properties allow it to participate in various chemical reactions, leading to the creation of a wide range of organic compounds with diverse applications.
Used as a Chelating Agent:
(4-OXO-4H-PYRIDIN-1-YL)ACETIC ACID has potential applications as a chelating agent, which involves the formation of multiple bonds between a single central atom and a chelating molecule. This property can be harnessed in various chemical processes, including the purification of metal ions and the stabilization of metal complexes.
Used in Supramolecular Chemistry:
In the field of supramolecular chemistry, (4-OXO-4H-PYRIDIN-1-YL)ACETIC ACID is employed in the development of novel materials. Its ability to form complexes and interact with other molecules makes it a valuable component in the design of new materials with unique properties and potential applications in various industries.

InChI:InChI=1/C7H7NO3/c9-6-1-3-8(4-2-6)5-7(10)11/h1-4H,5H2,(H,10,11)

Upstream product

• 626-64-2 pyridin-4-ol 
• 79-11-8 chloroacetic acid 

Downstream Products

• 1399857-73-8 1-((6-(4-fluorophenyl)[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl)pyridin-4(1H)-one 

Relevant academic research and scientific papers

7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them

The compounds of this invention are cephalosporins having various acyl substituents at the 7-position and a sulfaminoalkyl substituted tetrazolylthiomethyl group at the 3-position of the cephem nucleus and intermediates for the preparation thereof. The 7-acylated cephalosporin compounds have antibacterial activity.

7β-Acylamino-3-(phosphonoalkyl and esterified phosphonoalkyl substituted tetrazolylthiomethyl)cephalosporins

The compounds of this invention are cephalosporins having various acylamino substituents at the 7-position and a phosphonoalkyl or esterified phosphonoalkyl substituted tetrazolylthiomethyl group at the 3-position of the cephem nucleus and intermediates for the preparation thereof. The 7-acylated compounds have antibacterial activity.

7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them

The compounds of this invention are cephalosporins having various acyl substituents at the 7-position and an alkanesulfonamidoalkyl substituted tetrazolylthiomethyl group at the 3-position of the cephem nucleus and intermediates for the preparation thereof. The 7-acylated compounds have antibacterial activity.

7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins

The compounds of this invention are cephalosporins having various acyl substituents at the 7-position and a carboxyalkyl or carbamoylalkyl substituted oxadiazolylthiomethyl group at the 3-position of the cephem nucleus and intermediates for the preparation thereof. The 7-acylated compounds have antibacterial activity.

7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins

The compounds of this invention are cephalosporins having various acyl substituents at the 7-position and an ureidoalkyl substituted tetrazolylthiomethyl group at the 3-position of the cephem nucleus and intermediates for the preparation thereof. The 7-acylated compounds have antibacterial activity.

4-Oxo-1-pyridinyl penicillin derivatives

Novel substituted(4-oxo-1-pyridinyl)acetylamino-penicillin and cephalosporin derivatives are prepared which are useful antibacterial agents.