4608-78-0

Usage

Uses

Used in Pharmaceutical Research:
1-(3-AMINO-PROPYL)-PIPERIDIN-4-OL is used as a building block in pharmaceutical research for the synthesis of various pharmaceuticals and bioactive compounds. Its unique structure allows for the development of new drugs with potential therapeutic benefits.
Used in Organic Synthesis:
1-(3-AMINO-PROPYL)-PIPERIDIN-4-OL is used as a key intermediate in organic synthesis for the preparation of complex organic molecules. Its versatile structure makes it a valuable component in the synthesis of a wide range of compounds.
Used in Drug Development:
1-(3-AMINO-PROPYL)-PIPERIDIN-4-OL has potential applications in the development of drugs for various medical conditions. Its unique structure and functional groups make it a promising candidate for the design and synthesis of new therapeutic agents.
Used in Chemical Research:
1-(3-AMINO-PROPYL)-PIPERIDIN-4-OL is used in chemical research to study the properties and reactivity of piperidine derivatives. Its unique structure provides insights into the behavior of similar compounds and contributes to the understanding of organic chemistry.

InChI:InChI=1/C8H18N2O/c9-4-1-5-10-6-2-8(11)3-7-10/h8,11H,1-7,9H2

Upstream product

• 670252-81-0 benzyl N-(3-(4-hydroxypiperidino)propyl)carbamate 
• 101620-70-6 2-(3-(4-Hydroxypiperidino)propyl)isoindolin-1,3-dione 

Downstream Products

• 1375737-05-5 N¹-(4-chlorophenyl)-N⁴-(3-(4-hydroxypiperidin-1-yl)propyl)succinamide 
• 1201691-90-8 4-(9-cyclopentyl-7,7-difluoro-5-methyl-6-oxo-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b][1,4]diazepin-2-ylamino)-N-[3-(4-hydroxy-piperidin-1-yl)-propyl]-3-methoxy-benzamide 
• 670252-81-0 benzyl N-(3-(4-hydroxypiperidino)propyl)carbamate 

Relevant academic research and scientific papers

INHIBITORS OF BACTERIAL GLYCOSYL TRANSFERASES

Described herein are compounds of Formula (I'), Formula (IA), Formulae (I)-(VII), pharmaceutically acceptable salts, solvates, hydrates, polymorphs, co-crystals, tautomers, stereoisomers, isotopically labeled derivatives, and prodrug sthereof. The invention also provides pharmaceutical compositions of the compounds for human and veterinary use. Compounds of the present invention are useful for inhibiting bacterial growth and therefore are useful in treating and/or preventing bacterial infections. Methods of using the compounds for treating and/or preventing a bacterial infection in a subject are also described.

AZAARENE DERIVATIVES

A compound represented by the general formula: wherein X1 represents a nitrogen atom or a group represented by the formula -CR10=; X2 represents a nitrogen atom or a group represented by the formula -CR11=; Y represents an oxygen atom or the like; R1 represents a C1-6 alkoxy group, an optionally substituted C6-10 aryloxy group, a group represented by the formula -NR12aR12b or the like; R2 represents a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like; R3, R4, R5, R6, R7, R8, R10 and R11 each independently represent a hydrogen atom, a halogen atom, an optionally substituted C1-6 alkyl group, or the like; R9 represents a group represented by the formula -NR16aR16b or the like; and R12a, R12b, R16a and R16b each independently represent a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like, a salt thereof, or a hydrate of the foregoing.