4608-79-1 Usage
Chemical class
Derivative of piperidine
Functional group
Amide
Applications
a. Synthesis of pharmaceutical drugs
b. Synthesis of organic compounds
c. Building block for complex molecules
d. Medicinal chemistry for drug development
e. Industrial applications (e.g., polymer production, organic synthesis)
Biological activities
Potential due to its structure
Structure
Contains an amide functional group and a 3-amino-propyl chain attached to a piperidine ring
Chemical properties
a. Reactivity with other compounds to form amide bonds
b. Potential for hydrogen bonding due to the presence of nitrogen atoms
c. Solubility in polar solvents (e.g., water, alcohols) due to its amide and amine groups
Stability
Generally stable under normal conditions, but may be sensitive to heat, light, or strong acids/bases
Safety
Handle with care, as it may have unknown toxicological properties or hazards
Purity
Typically synthesized with high purity for use in pharmaceutical and chemical applications
Check Digit Verification of cas no
The CAS Registry Mumber 4608-79-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,0 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4608-79:
(6*4)+(5*6)+(4*0)+(3*8)+(2*7)+(1*9)=101
101 % 10 = 1
So 4608-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H19N3O/c10-4-1-5-12-6-2-8(3-7-12)9(11)13/h8H,1-7,10H2,(H2,11,13)
