4608-80-4 Usage
Uses
Used in Pharmaceutical Research and Development:
1-(2-Cyanoethyl)piperidine-4-carboxamide is used as a pharmaceutical intermediate for its potential to be developed into drugs with antiviral, antitumor, and anti-inflammatory properties. The presence of the nitrile and carboxamide functional groups allows for further chemical modifications and the exploration of its therapeutic potential.
Used in Antiviral Applications:
In the field of antiviral research, 1-(2-Cyanoethyl)piperidine-4-carboxamide is used as a compound with potential antiviral properties. Its structure and functional groups may be optimized to target specific viral mechanisms, potentially leading to the development of new antiviral drugs.
Used in Antitumor Applications:
1-(2-Cyanoethyl)piperidine-4-carboxamide is used as a compound with potential antitumor properties. Its ability to interact with various biological targets makes it a candidate for the development of novel cancer therapies, particularly if its structure can be further optimized to enhance its efficacy and selectivity.
Used in Anti-Inflammatory Applications:
In the realm of anti-inflammatory drug development, 1-(2-Cyanoethyl)piperidine-4-carboxamide is used as a compound with potential anti-inflammatory properties. Its cyclic amine structure and functional groups may be leveraged to modulate inflammatory pathways, offering a new avenue for the treatment of inflammatory diseases.
Overall, 1-(2-Cyanoethyl)piperidine-4-carboxamide is a versatile and promising chemical compound with a wide range of potential applications in the pharmaceutical industry, particularly in the development of new drugs for antiviral, antitumor, and anti-inflammatory therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 4608-80-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,0 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4608-80:
(6*4)+(5*6)+(4*0)+(3*8)+(2*8)+(1*0)=94
94 % 10 = 4
So 4608-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H15N3O/c10-4-1-5-12-6-2-8(3-7-12)9(11)13/h8H,1-3,5-7H2,(H2,11,13)
