461036-88-4 Usage
Uses
Used in Medicinal Chemistry Research:
4,6-Dichloro-2-(4-fluoro-phenyl)quinazoline is used as a chemical precursor for the synthesis of more complex compounds in medicinal chemistry. Its presence as a quinazoline derivative allows for the development of new pharmaceutical drugs with potential therapeutic applications.
Used in Drug Synthesis:
4,6-DICHLORO-2-(4-FLUORO-PHENYL)-QUINAZOLINE is employed as a key intermediate in the synthesis of various drugs, particularly those that require the quinazoline core structure. The presence of chlorine and fluorine atoms on its structure facilitates further chemical reactions, making it a versatile building block for drug development.
Used in Laboratory Settings:
4,6-Dichloro-2-(4-fluoro-phenyl)quinazoline is used as a research compound in controlled laboratory environments. Its synthesis and subsequent reactions are studied to understand its potential applications and to develop new methodologies for the creation of pharmaceutical compounds.
Used in Chemical Synthesis Education:
In educational settings, particularly in chemistry courses, 4,6-dichlor0-2-(4-fluoro-phenyl)quinazoline can be used as a teaching aid to demonstrate the principles of organic synthesis, substitution reactions, and the role of functional groups in drug design.
Check Digit Verification of cas no
The CAS Registry Mumber 461036-88-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,6,1,0,3 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 461036-88:
(8*4)+(7*6)+(6*1)+(5*0)+(4*3)+(3*6)+(2*8)+(1*8)=134
134 % 10 = 4
So 461036-88-4 is a valid CAS Registry Number.
InChI:InChI=1S/C15H10Cl2N2O/c1-20-11-5-2-9(3-6-11)15-18-13-7-4-10(16)8-12(13)14(17)19-15/h2-8H,1H3
