462-17-9 Usage
Classification
Ketone
A functional group present in the molecule, characterized by a carbonyl group (C=O) bonded to two other carbon atoms.
Fluorine content
Two fluorine atoms
The presence of two fluorine atoms in the molecule, which can influence its reactivity and properties.
Carbon chain length
10-carbon chain
The length of the carbon chain in the molecule, which can affect its physical and chemical properties.
Synthetic compound
Yes
Indicates that the compound is artificially synthesized, rather than being naturally occurring.
Industrial applications
Various
The compound is used in the manufacturing of different industrial products, including pharmaceuticals and agricultural chemicals.
Building block
Synthesis of other organic compounds
It can be used as a starting material for the synthesis of other organic compounds, making it versatile in chemical reactions.
Potential applications
Chemistry, materials science, and drug discovery
The compound has potential uses in these fields due to its unique properties and reactivity.
Usefulness
Wide range of purposes in different industries
Its properties make it valuable for various applications across multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 462-17-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,6 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 462-17:
(5*4)+(4*6)+(3*2)+(2*1)+(1*7)=59
59 % 10 = 9
So 462-17-9 is a valid CAS Registry Number.
InChI:InChI=1/C19H36F2O/c20-17-13-9-5-1-3-7-11-15-19(22)16-12-8-4-2-6-10-14-18-21/h1-18H2